C19H37F3 — CID 172743472
7-(1,1,1-trifluoro-2-methylpropan-2-yl)pentadecane (PubChem CID 172743472) has the molecular formula C19H37F3 and a molecular weight of 322.50 g/mol. Its IUPAC name is 7-(1,1,1-trifluoro-2-methylpropan-2-yl)pentadecane.
| Compound Name | 7-(1,1,1-trifluoro-2-methylpropan-2-yl)pentadecane |
|---|---|
| PubChem CID | 172743472 |
| Molecular Formula | C19H37F3 |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.28 |
| IUPAC Name | 7-(1,1,1-trifluoro-2-methylpropan-2-yl)pentadecane |
| SMILES | CCCCCCCCC(CCCCCC)C(C)(C)C(F)(F)F |
| InChI | InChI=1S/C19H37F3/c1-5-7-9-11-12-14-16-17(15-13-10-8-6-2)18(3,4)19(20,21)22/h17H,5-16H2,1-4H3 |
| InChIKey | JKFZWGAXQWQRDJ-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|