C13H21F7 — CID 58419046
1,1,1,2-tetrafluoro-2-methyl-6-(trifluoromethyl)undecane (PubChem CID 58419046) has the molecular formula C13H21F7 and a molecular weight of 310.30 g/mol. Its IUPAC name is 1,1,1,2-tetrafluoro-2-methyl-6-(trifluoromethyl)undecane.
| Compound Name | 1,1,1,2-tetrafluoro-2-methyl-6-(trifluoromethyl)undecane |
|---|---|
| PubChem CID | 58419046 |
| Molecular Formula | C13H21F7 |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 1,1,1,2-tetrafluoro-2-methyl-6-(trifluoromethyl)undecane |
| SMILES | CCCCCC(CCCC(C)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H21F7/c1-3-4-5-7-10(12(15,16)17)8-6-9-11(2,14)13(18,19)20/h10H,3-9H2,1-2H3 |
| InChIKey | BFDPHMTYRDVGFR-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|