C17H34F2 — CID 88795161
6-(4,4-difluorobutyl)-5,5-dimethylundecane (PubChem CID 88795161) has the molecular formula C17H34F2 and a molecular weight of 276.45 g/mol. Its IUPAC name is 6-(4,4-difluorobutyl)-5,5-dimethylundecane.
| Compound Name | 6-(4,4-difluorobutyl)-5,5-dimethylundecane |
|---|---|
| PubChem CID | 88795161 |
| Molecular Formula | C17H34F2 |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.26 |
| IUPAC Name | 6-(4,4-difluorobutyl)-5,5-dimethylundecane |
| SMILES | CCCCCC(CCCC(F)F)C(C)(C)CCCC |
| InChI | InChI=1S/C17H34F2/c1-5-7-9-11-15(12-10-13-16(18)19)17(3,4)14-8-6-2/h15-16H,5-14H2,1-4H3 |
| InChIKey | XMVLWCFTYPEUCU-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|