C19H38F2O3 — CID 150523131
1,1-difluoro-4-(triethoxymethyl)dodecane (PubChem CID 150523131) has the molecular formula C19H38F2O3 and a molecular weight of 352.51 g/mol. Its IUPAC name is 1,1-difluoro-4-(triethoxymethyl)dodecane.
| Compound Name | 1,1-difluoro-4-(triethoxymethyl)dodecane |
|---|---|
| PubChem CID | 150523131 |
| Molecular Formula | C19H38F2O3 |
| Molecular Weight | 352.51 g/mol |
| Exact Mass | 352.28 |
| IUPAC Name | 1,1-difluoro-4-(triethoxymethyl)dodecane |
| SMILES | CCCCCCCCC(CCC(F)F)C(OCC)(OCC)OCC |
| InChI | InChI=1S/C19H38F2O3/c1-5-9-10-11-12-13-14-17(15-16-18(20)21)19(22-6-2,23-7-3)24-8-4/h17-18H,5-16H2,1-4H3 |
| InChIKey | ICGLVSSRCCOSOW-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.51 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|