C25H39F5O4 — CID 151799681
1,2,3,4,5-pentafluoro-6-[4-(triethoxymethyl)dodecoxy]benzene (PubChem CID 151799681) has the molecular formula C25H39F5O4 and a molecular weight of 498.57 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-[4-(triethoxymethyl)dodecoxy]benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-[4-(triethoxymethyl)dodecoxy]benzene |
|---|---|
| PubChem CID | 151799681 |
| Molecular Formula | C25H39F5O4 |
| Molecular Weight | 498.57 g/mol |
| Exact Mass | 498.28 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-[4-(triethoxymethyl)dodecoxy]benzene |
| SMILES | CCCCCCCCC(CCCOc1c(F)c(F)c(F)c(F)c1F)C(OCC)(OCC)OCC |
| InChI | InChI=1S/C25H39F5O4/c1-5-9-10-11-12-13-15-18(25(32-6-2,33-7-3)34-8-4)16-14-17-31-24-22(29)20(27)19(26)21(28)23(24)30/h18H,5-17H2,1-4H3 |
| InChIKey | RYIRVUDSMSCIDF-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.57 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|