C28H47F3O3 — CID 172700843
1,2,4-trifluoro-5-[4-(tripropoxymethyl)dodecyl]benzene (PubChem CID 172700843) has the molecular formula C28H47F3O3 and a molecular weight of 488.68 g/mol. Its IUPAC name is 1,2,4-trifluoro-5-[4-(tripropoxymethyl)dodecyl]benzene.
| Compound Name | 1,2,4-trifluoro-5-[4-(tripropoxymethyl)dodecyl]benzene |
|---|---|
| PubChem CID | 172700843 |
| Molecular Formula | C28H47F3O3 |
| Molecular Weight | 488.68 g/mol |
| Exact Mass | 488.35 |
| IUPAC Name | 1,2,4-trifluoro-5-[4-(tripropoxymethyl)dodecyl]benzene |
| SMILES | CCCCCCCCC(CCCc1cc(F)c(F)cc1F)C(OCCC)(OCCC)OCCC |
| InChI | InChI=1S/C28H47F3O3/c1-5-9-10-11-12-13-16-24(17-14-15-23-21-26(30)27(31)22-25(23)29)28(32-18-6-2,33-19-7-3)34-20-8-4/h21-22,24H,5-20H2,1-4H3 |
| InChIKey | CYCWREPTKBOTQX-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.68 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|