C22H35F3O3 — CID 152537274
1,1-diethoxy-2-[2-(2,4,5-trifluorophenyl)ethyl]decan-1-ol (PubChem CID 152537274) has the molecular formula C22H35F3O3 and a molecular weight of 404.51 g/mol. Its IUPAC name is 1,1-diethoxy-2-[2-(2,4,5-trifluorophenyl)ethyl]decan-1-ol.
| Compound Name | 1,1-diethoxy-2-[2-(2,4,5-trifluorophenyl)ethyl]decan-1-ol |
|---|---|
| PubChem CID | 152537274 |
| Molecular Formula | C22H35F3O3 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | 1,1-diethoxy-2-[2-(2,4,5-trifluorophenyl)ethyl]decan-1-ol |
| SMILES | CCCCCCCCC(CCc1cc(F)c(F)cc1F)C(O)(OCC)OCC |
| InChI | InChI=1S/C22H35F3O3/c1-4-7-8-9-10-11-12-18(22(26,27-5-2)28-6-3)14-13-17-15-20(24)21(25)16-19(17)23/h15-16,18,26H,4-14H2,1-3H3 |
| InChIKey | YKUKMPFNTDHWBR-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|