C25H40F4O — CID 151419404
1-[6-(2-ethoxypropan-2-yl)tetradecyl]-2,3,4,5-tetrafluorobenzene (PubChem CID 151419404) has the molecular formula C25H40F4O and a molecular weight of 432.59 g/mol. Its IUPAC name is 1-[6-(2-ethoxypropan-2-yl)tetradecyl]-2,3,4,5-tetrafluorobenzene.
| Compound Name | 1-[6-(2-ethoxypropan-2-yl)tetradecyl]-2,3,4,5-tetrafluorobenzene |
|---|---|
| PubChem CID | 151419404 |
| Molecular Formula | C25H40F4O |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.30 |
| IUPAC Name | 1-[6-(2-ethoxypropan-2-yl)tetradecyl]-2,3,4,5-tetrafluorobenzene |
| SMILES | CCCCCCCCC(CCCCCc1cc(F)c(F)c(F)c1F)C(C)(C)OCC |
| InChI | InChI=1S/C25H40F4O/c1-5-7-8-9-10-13-16-20(25(3,4)30-6-2)17-14-11-12-15-19-18-21(26)23(28)24(29)22(19)27/h18,20H,5-17H2,1-4H3 |
| InChIKey | PAFNKDXWRDVKNZ-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|