C23H38F2O — CID 150155603
4-[4-(2-ethoxypropan-2-yl)dodecyl]-1,2-difluorobenzene (PubChem CID 150155603) has the molecular formula C23H38F2O and a molecular weight of 368.55 g/mol. Its IUPAC name is 4-[4-(2-ethoxypropan-2-yl)dodecyl]-1,2-difluorobenzene.
| Compound Name | 4-[4-(2-ethoxypropan-2-yl)dodecyl]-1,2-difluorobenzene |
|---|---|
| PubChem CID | 150155603 |
| Molecular Formula | C23H38F2O |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.29 |
| IUPAC Name | 4-[4-(2-ethoxypropan-2-yl)dodecyl]-1,2-difluorobenzene |
| SMILES | CCCCCCCCC(CCCc1ccc(F)c(F)c1)C(C)(C)OCC |
| InChI | InChI=1S/C23H38F2O/c1-5-7-8-9-10-11-14-20(23(3,4)26-6-2)15-12-13-19-16-17-21(24)22(25)18-19/h16-18,20H,5-15H2,1-4H3 |
| InChIKey | FGDXANHIJQQXJO-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|