C23H37F3O2 — CID 150057773
5-[4-(1,1-dimethoxypropyl)dodecyl]-1,2,3-trifluorobenzene (PubChem CID 150057773) has the molecular formula C23H37F3O2 and a molecular weight of 402.54 g/mol. Its IUPAC name is 5-[4-(1,1-dimethoxypropyl)dodecyl]-1,2,3-trifluorobenzene.
| Compound Name | 5-[4-(1,1-dimethoxypropyl)dodecyl]-1,2,3-trifluorobenzene |
|---|---|
| PubChem CID | 150057773 |
| Molecular Formula | C23H37F3O2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.27 |
| IUPAC Name | 5-[4-(1,1-dimethoxypropyl)dodecyl]-1,2,3-trifluorobenzene |
| SMILES | CCCCCCCCC(CCCc1cc(F)c(F)c(F)c1)C(CC)(OC)OC |
| InChI | InChI=1S/C23H37F3O2/c1-5-7-8-9-10-11-14-19(23(6-2,27-3)28-4)15-12-13-18-16-20(24)22(26)21(25)17-18/h16-17,19H,5-15H2,1-4H3 |
| InChIKey | DMQSXWPNQFJPLI-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|