C24H39F3O3 — CID 151729721
1,2,3-trifluoro-5-[6-(trimethoxymethyl)tetradecyl]benzene (PubChem CID 151729721) has the molecular formula C24H39F3O3 and a molecular weight of 432.57 g/mol. Its IUPAC name is 1,2,3-trifluoro-5-[6-(trimethoxymethyl)tetradecyl]benzene.
| Compound Name | 1,2,3-trifluoro-5-[6-(trimethoxymethyl)tetradecyl]benzene |
|---|---|
| PubChem CID | 151729721 |
| Molecular Formula | C24H39F3O3 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.29 |
| IUPAC Name | 1,2,3-trifluoro-5-[6-(trimethoxymethyl)tetradecyl]benzene |
| SMILES | CCCCCCCCC(CCCCCc1cc(F)c(F)c(F)c1)C(OC)(OC)OC |
| InChI | InChI=1S/C24H39F3O3/c1-5-6-7-8-9-12-15-20(24(28-2,29-3)30-4)16-13-10-11-14-19-17-21(25)23(27)22(26)18-19/h17-18,20H,5-16H2,1-4H3 |
| InChIKey | RKHRYOIBESYJPN-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|