C25H42F2O2 — CID 150001543
4-[6-(1,1-dimethoxypropyl)tetradecyl]-1,2-difluorobenzene (PubChem CID 150001543) has the molecular formula C25H42F2O2 and a molecular weight of 412.61 g/mol. Its IUPAC name is 4-[6-(1,1-dimethoxypropyl)tetradecyl]-1,2-difluorobenzene.
| Compound Name | 4-[6-(1,1-dimethoxypropyl)tetradecyl]-1,2-difluorobenzene |
|---|---|
| PubChem CID | 150001543 |
| Molecular Formula | C25H42F2O2 |
| Molecular Weight | 412.61 g/mol |
| Exact Mass | 412.32 |
| IUPAC Name | 4-[6-(1,1-dimethoxypropyl)tetradecyl]-1,2-difluorobenzene |
| SMILES | CCCCCCCCC(CCCCCc1ccc(F)c(F)c1)C(CC)(OC)OC |
| InChI | InChI=1S/C25H42F2O2/c1-5-7-8-9-10-13-16-22(25(6-2,28-3)29-4)17-14-11-12-15-21-18-19-23(26)24(27)20-21/h18-20,22H,5-17H2,1-4H3 |
| InChIKey | DBJXWHUACUZIEH-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.61 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|