C24H41FO2 — CID 150917008
1-[6-(1,1-dimethoxyethyl)tetradecyl]-4-fluorobenzene (PubChem CID 150917008) has the molecular formula C24H41FO2 and a molecular weight of 380.59 g/mol. Its IUPAC name is 1-[6-(1,1-dimethoxyethyl)tetradecyl]-4-fluorobenzene.
| Compound Name | 1-[6-(1,1-dimethoxyethyl)tetradecyl]-4-fluorobenzene |
|---|---|
| PubChem CID | 150917008 |
| Molecular Formula | C24H41FO2 |
| Molecular Weight | 380.59 g/mol |
| Exact Mass | 380.31 |
| IUPAC Name | 1-[6-(1,1-dimethoxyethyl)tetradecyl]-4-fluorobenzene |
| SMILES | CCCCCCCCC(CCCCCc1ccc(F)cc1)C(C)(OC)OC |
| InChI | InChI=1S/C24H41FO2/c1-5-6-7-8-9-12-15-22(24(2,26-3)27-4)16-13-10-11-14-21-17-19-23(25)20-18-21/h17-20,22H,5-16H2,1-4H3 |
| InChIKey | LDFINELKSUMMNM-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.59 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|