C23H41NO2 — CID 151722105
N-[5-(1,1-dimethoxyethyl)tridecyl]aniline (PubChem CID 151722105) has the molecular formula C23H41NO2 and a molecular weight of 363.59 g/mol. Its IUPAC name is N-[5-(1,1-dimethoxyethyl)tridecyl]aniline.
| Compound Name | N-[5-(1,1-dimethoxyethyl)tridecyl]aniline |
|---|---|
| PubChem CID | 151722105 |
| Molecular Formula | C23H41NO2 |
| Molecular Weight | 363.59 g/mol |
| Exact Mass | 363.31 |
| IUPAC Name | N-[5-(1,1-dimethoxyethyl)tridecyl]aniline |
| SMILES | CCCCCCCCC(CCCCNc1ccccc1)C(C)(OC)OC |
| InChI | InChI=1S/C23H41NO2/c1-5-6-7-8-9-11-16-21(23(2,25-3)26-4)17-14-15-20-24-22-18-12-10-13-19-22/h10,12-13,18-19,21,24H,5-9,11,14-17,20H2,1-4H3 |
| InChIKey | RIUNHYHRTNJOCE-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.59 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|