C19H32O2 — CID 152553562
2,2-dimethoxyundecan-3-ylbenzene (PubChem CID 152553562) has the molecular formula C19H32O2 and a molecular weight of 292.46 g/mol. Its IUPAC name is 2,2-dimethoxyundecan-3-ylbenzene.
| Compound Name | 2,2-dimethoxyundecan-3-ylbenzene |
|---|---|
| PubChem CID | 152553562 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | 2,2-dimethoxyundecan-3-ylbenzene |
| SMILES | CCCCCCCCC(c1ccccc1)C(C)(OC)OC |
| InChI | InChI=1S/C19H32O2/c1-5-6-7-8-9-13-16-18(19(2,20-3)21-4)17-14-11-10-12-15-17/h10-12,14-15,18H,5-9,13,16H2,1-4H3 |
| InChIKey | YNZNPUMYOBTIFA-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|