C17H26Cl2 — CID 151571814
2,2-dichloroundecan-3-ylbenzene (PubChem CID 151571814) has the molecular formula C17H26Cl2 and a molecular weight of 301.30 g/mol. Its IUPAC name is 2,2-dichloroundecan-3-ylbenzene.
| Compound Name | 2,2-dichloroundecan-3-ylbenzene |
|---|---|
| PubChem CID | 151571814 |
| Molecular Formula | C17H26Cl2 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 2,2-dichloroundecan-3-ylbenzene |
| SMILES | CCCCCCCCC(c1ccccc1)C(C)(Cl)Cl |
| InChI | InChI=1S/C17H26Cl2/c1-3-4-5-6-7-11-14-16(17(2,18)19)15-12-9-8-10-13-15/h8-10,12-13,16H,3-7,11,14H2,1-2H3 |
| InChIKey | QEPLZKKNIDWBJQ-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|