C20H34O2 — CID 151688969
2-(1,1-dimethoxyethyl)decylbenzene (PubChem CID 151688969) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is 2-(1,1-dimethoxyethyl)decylbenzene.
| Compound Name | 2-(1,1-dimethoxyethyl)decylbenzene |
|---|---|
| PubChem CID | 151688969 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | 2-(1,1-dimethoxyethyl)decylbenzene |
| SMILES | CCCCCCCCC(Cc1ccccc1)C(C)(OC)OC |
| InChI | InChI=1S/C20H34O2/c1-5-6-7-8-9-13-16-19(20(2,21-3)22-4)17-18-14-11-10-12-15-18/h10-12,14-15,19H,5-9,13,16-17H2,1-4H3 |
| InChIKey | RCDNRRMKFKDANL-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|