About (3-benzyl-2-methyldecan-2-yl)phosphane;hydroiodide
(3-benzyl-2-methyldecan-2-yl)phosphane;hydroiodide (PubChem CID 173157860) has the molecular formula C18H32IP
and a molecular weight of 406.33 g/mol. Its IUPAC name is (3-benzyl-2-methyldecan-2-yl)phosphane;hydroiodide.
Molecular Properties
| Compound Name | (3-benzyl-2-methyldecan-2-yl)phosphane;hydroiodide |
| PubChem CID | 173157860 |
| Molecular Formula | C18H32IP |
| Molecular Weight | 406.33 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | (3-benzyl-2-methyldecan-2-yl)phosphane;hydroiodide |
| SMILES | CCCCCCCC(Cc1ccccc1)C(C)(C)P.I |
| InChI | InChI=1S/C18H31P.HI/c1-4-5-6-7-11-14-17(18(2,3)19)15-16-12-9-8-10-13-16;/h8-10,12-13,17H,4-7,11,14-15,19H2,1-3H3;1H |
| InChIKey | MOMLBVXDMXWTIL-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.33 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (3-benzyl-2-methyldecan-2-yl)phosphane;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-benzyl-2-methyldecan-2-yl)phosphane;hydroiodide?
The IUPAC name of (3-benzyl-2-methyldecan-2-yl)phosphane;hydroiodide (CID 173157860) is (3-benzyl-2-methyldecan-2-yl)phosphane;hydroiodide.
What is the SMILES notation for (3-benzyl-2-methyldecan-2-yl)phosphane;hydroiodide?
The canonical SMILES for (3-benzyl-2-methyldecan-2-yl)phosphane;hydroiodide is CCCCCCCC(Cc1ccccc1)C(C)(C)P.I.
What is the InChIKey of (3-benzyl-2-methyldecan-2-yl)phosphane;hydroiodide?
The InChIKey is MOMLBVXDMXWTIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H31P.HI/c1-4-5-6-7-11-14-17(18(2,3)19)15-16-12-9-8-10-13-16;/h8-10,12-13,17H,4-7,11,14-15,19H2,1-3H3;1H.
What are the key properties of (3-benzyl-2-methyldecan-2-yl)phosphane;hydroiodide?
(3-benzyl-2-methyldecan-2-yl)phosphane;hydroiodide has a molecular weight of 406.33 g/mol, XLogP of 6.48, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3-benzyl-2-methyldecan-2-yl)phosphane;hydroiodide is sourced from PubChem (CID 173157860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).