About (6-benzyl-5-butyltetradecan-5-yl)arsane;hydrate
(6-benzyl-5-butyltetradecan-5-yl)arsane;hydrate (PubChem CID 173347263) has the molecular formula C25H47AsO
and a molecular weight of 438.57 g/mol. Its IUPAC name is (6-benzyl-5-butyltetradecan-5-yl)arsane;hydrate.
Molecular Properties
| Compound Name | (6-benzyl-5-butyltetradecan-5-yl)arsane;hydrate |
| PubChem CID | 173347263 |
| Molecular Formula | C25H47AsO |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | (6-benzyl-5-butyltetradecan-5-yl)arsane;hydrate |
| SMILES | CCCCCCCCC(Cc1ccccc1)C([AsH2])(CCCC)CCCC.O |
| InChI | InChI=1S/C25H45As.H2O/c1-4-7-10-11-12-16-19-24(22-23-17-14-13-15-18-23)25(26,20-8-5-2)21-9-6-3;/h13-15,17-18,24H,4-12,16,19-22,26H2,1-3H3;1H2 |
| InChIKey | MKOKOXUHGRIOMO-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 31.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (6-benzyl-5-butyltetradecan-5-yl)arsane;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-benzyl-5-butyltetradecan-5-yl)arsane;hydrate?
The IUPAC name of (6-benzyl-5-butyltetradecan-5-yl)arsane;hydrate (CID 173347263) is (6-benzyl-5-butyltetradecan-5-yl)arsane;hydrate.
What is the SMILES notation for (6-benzyl-5-butyltetradecan-5-yl)arsane;hydrate?
The canonical SMILES for (6-benzyl-5-butyltetradecan-5-yl)arsane;hydrate is CCCCCCCCC(Cc1ccccc1)C([AsH2])(CCCC)CCCC.O.
What is the InChIKey of (6-benzyl-5-butyltetradecan-5-yl)arsane;hydrate?
The InChIKey is MKOKOXUHGRIOMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H45As.H2O/c1-4-7-10-11-12-16-19-24(22-23-17-14-13-15-18-23)25(26,20-8-5-2)21-9-6-3;/h13-15,17-18,24H,4-12,16,19-22,26H2,1-3H3;1H2.
What are the key properties of (6-benzyl-5-butyltetradecan-5-yl)arsane;hydrate?
(6-benzyl-5-butyltetradecan-5-yl)arsane;hydrate has a molecular weight of 438.57 g/mol, XLogP of 6.94, 16 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (6-benzyl-5-butyltetradecan-5-yl)arsane;hydrate is sourced from PubChem (CID 173347263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).