C21H33Cl3O — CID 152703640
2-(1,1,1-trichloro-2-methoxypentan-2-yl)nonylbenzene (PubChem CID 152703640) has the molecular formula C21H33Cl3O and a molecular weight of 407.85 g/mol. Its IUPAC name is 2-(1,1,1-trichloro-2-methoxypentan-2-yl)nonylbenzene.
| Compound Name | 2-(1,1,1-trichloro-2-methoxypentan-2-yl)nonylbenzene |
|---|---|
| PubChem CID | 152703640 |
| Molecular Formula | C21H33Cl3O |
| Molecular Weight | 407.85 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 2-(1,1,1-trichloro-2-methoxypentan-2-yl)nonylbenzene |
| SMILES | CCCCCCCC(Cc1ccccc1)C(CCC)(OC)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C21H33Cl3O/c1-4-6-7-8-12-15-19(17-18-13-10-9-11-14-18)20(25-3,16-5-2)21(22,23)24/h9-11,13-14,19H,4-8,12,15-17H2,1-3H3 |
| InChIKey | ZSCKFLKQMNLKHT-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.85 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|