C25H31F5O2 — CID 150894829
1-[4-(2,2-dimethoxyundecan-3-yl)phenyl]-2,3,4,5,6-pentafluorobenzene (PubChem CID 150894829) has the molecular formula C25H31F5O2 and a molecular weight of 458.51 g/mol. Its IUPAC name is 1-[4-(2,2-dimethoxyundecan-3-yl)phenyl]-2,3,4,5,6-pentafluorobenzene.
| Compound Name | 1-[4-(2,2-dimethoxyundecan-3-yl)phenyl]-2,3,4,5,6-pentafluorobenzene |
|---|---|
| PubChem CID | 150894829 |
| Molecular Formula | C25H31F5O2 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | 1-[4-(2,2-dimethoxyundecan-3-yl)phenyl]-2,3,4,5,6-pentafluorobenzene |
| SMILES | CCCCCCCCC(c1ccc(-c2c(F)c(F)c(F)c(F)c2F)cc1)C(C)(OC)OC |
| InChI | InChI=1S/C25H31F5O2/c1-5-6-7-8-9-10-11-18(25(2,31-3)32-4)16-12-14-17(15-13-16)19-20(26)22(28)24(30)23(29)21(19)27/h12-15,18H,5-11H2,1-4H3 |
| InChIKey | KYTPEBYUSZALTD-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|