C15H23F — CID 21304853
1-(2,2-dimethylheptan-3-yl)-4-fluorobenzene (PubChem CID 21304853) has the molecular formula C15H23F and a molecular weight of 222.35 g/mol. Its IUPAC name is 1-(2,2-dimethylheptan-3-yl)-4-fluorobenzene.
| Compound Name | 1-(2,2-dimethylheptan-3-yl)-4-fluorobenzene |
|---|---|
| PubChem CID | 21304853 |
| Molecular Formula | C15H23F |
| Molecular Weight | 222.35 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | 1-(2,2-dimethylheptan-3-yl)-4-fluorobenzene |
| SMILES | CCCCC(c1ccc(F)cc1)C(C)(C)C |
| InChI | InChI=1S/C15H23F/c1-5-6-7-14(15(2,3)4)12-8-10-13(16)11-9-12/h8-11,14H,5-7H2,1-4H3 |
| InChIKey | UTQJQCXEFDGQAH-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.35 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |