C28H35BF3NO3 — CID 173097118
hydroxy-[1,1,2-tris(4-fluorophenyl)hexoxy]borinate;tetramethylazanium (PubChem CID 173097118) has the molecular formula C28H35BF3NO3 and a molecular weight of 501.40 g/mol. Its IUPAC name is hydroxy-[1,1,2-tris(4-fluorophenyl)hexoxy]borinate;tetramethylazanium.
| Compound Name | hydroxy-[1,1,2-tris(4-fluorophenyl)hexoxy]borinate;tetramethylazanium |
|---|---|
| PubChem CID | 173097118 |
| Molecular Formula | C28H35BF3NO3 |
| Molecular Weight | 501.40 g/mol |
| Exact Mass | 501.27 |
| IUPAC Name | hydroxy-[1,1,2-tris(4-fluorophenyl)hexoxy]borinate;tetramethylazanium |
| SMILES | CCCCC(c1ccc(F)cc1)C(OB([O-])O)(c1ccc(F)cc1)c1ccc(F)cc1.C[N+](C)(C)C |
| InChI | InChI=1S/C24H23BF3O3.C4H12N/c1-2-3-4-23(17-5-11-20(26)12-6-17)24(31-25(29)30,18-7-13-21(27)14-8-18)19-9-15-22(28)16-10-19;1-5(2,3)4/h5-16,23,29H,2-4H2,1H3;1-4H3/q-1;+1 |
| InChIKey | PKLMVEXMFWHVHK-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 52.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.40 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|