C27H36BNO4 — CID 173335294
2-hydroxyethyl(trimethyl)azanium;hydroxy(1,1,2-triphenylbutoxy)borinate (PubChem CID 173335294) has the molecular formula C27H36BNO4 and a molecular weight of 449.40 g/mol. Its IUPAC name is 2-hydroxyethyl(trimethyl)azanium;hydroxy(1,1,2-triphenylbutoxy)borinate.
| Compound Name | 2-hydroxyethyl(trimethyl)azanium;hydroxy(1,1,2-triphenylbutoxy)borinate |
|---|---|
| PubChem CID | 173335294 |
| Molecular Formula | C27H36BNO4 |
| Molecular Weight | 449.40 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | 2-hydroxyethyl(trimethyl)azanium;hydroxy(1,1,2-triphenylbutoxy)borinate |
| SMILES | CCC(c1ccccc1)C(OB([O-])O)(c1ccccc1)c1ccccc1.C[N+](C)(C)CCO |
| InChI | InChI=1S/C22H22BO3.C5H14NO/c1-2-21(18-12-6-3-7-13-18)22(26-23(24)25,19-14-8-4-9-15-19)20-16-10-5-11-17-20;1-6(2,3)4-5-7/h3-17,21,24H,2H2,1H3;7H,4-5H2,1-3H3/q-1;+1 |
| InChIKey | FFWYVTJLTIBCDS-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 72.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|