C26H31BO3 — CID 70257152
1,1,2-triphenyloctoxyboronic acid (PubChem CID 70257152) has the molecular formula C26H31BO3 and a molecular weight of 402.34 g/mol. Its IUPAC name is 1,1,2-triphenyloctoxyboronic acid.
| Compound Name | 1,1,2-triphenyloctoxyboronic acid |
|---|---|
| PubChem CID | 70257152 |
| Molecular Formula | C26H31BO3 |
| Molecular Weight | 402.34 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | 1,1,2-triphenyloctoxyboronic acid |
| SMILES | CCCCCCC(c1ccccc1)C(OB(O)O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H31BO3/c1-2-3-4-14-21-25(22-15-8-5-9-16-22)26(30-27(28)29,23-17-10-6-11-18-23)24-19-12-7-13-20-24/h5-13,15-20,25,28-29H,2-4,14,21H2,1H3 |
| InChIKey | KHEYGMQWJVGSQJ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.34 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|