C22H24BNaO3 — CID 173273696
sodium;hydride;1,1,2-triphenylbutoxyboronic acid (PubChem CID 173273696) has the molecular formula C22H24BNaO3 and a molecular weight of 370.23 g/mol. Its IUPAC name is sodium;hydride;1,1,2-triphenylbutoxyboronic acid.
| Compound Name | sodium;hydride;1,1,2-triphenylbutoxyboronic acid |
|---|---|
| PubChem CID | 173273696 |
| Molecular Formula | C22H24BNaO3 |
| Molecular Weight | 370.23 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | sodium;hydride;1,1,2-triphenylbutoxyboronic acid |
| SMILES | CCC(c1ccccc1)C(OB(O)O)(c1ccccc1)c1ccccc1.[H-].[Na+] |
| InChI | InChI=1S/C22H23BO3.Na.H/c1-2-21(18-12-6-3-7-13-18)22(26-23(24)25,19-14-8-4-9-15-19)20-16-10-5-11-17-20;;/h3-17,21,24-25H,2H2,1H3;;/q;+1;-1 |
| InChIKey | QEHWYZYCZOAPHX-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.23 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|