C13H19F3 — CID 170769843
ethane;[(2S)-1,1,1-trifluoropentan-2-yl]benzene (PubChem CID 170769843) has the molecular formula C13H19F3 and a molecular weight of 232.29 g/mol. Its IUPAC name is ethane;[(2S)-1,1,1-trifluoropentan-2-yl]benzene.
| Compound Name | ethane;[(2S)-1,1,1-trifluoropentan-2-yl]benzene |
|---|---|
| PubChem CID | 170769843 |
| Molecular Formula | C13H19F3 |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | ethane;[(2S)-1,1,1-trifluoropentan-2-yl]benzene |
| SMILES | CC.CCC[C@@H](c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C11H13F3.C2H6/c1-2-6-10(11(12,13)14)9-7-4-3-5-8-9;1-2/h3-5,7-8,10H,2,6H2,1H3;1-2H3/t10-;/m0./s1 |
| InChIKey | LGORPACOBGXIPW-PPHPATTJSA-N |
| XLogP | 5.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |