C14H19F3 — CID 137470880
(6,6,6-trifluoro-2,2-dimethylhexan-3-yl)benzene (PubChem CID 137470880) has the molecular formula C14H19F3 and a molecular weight of 244.30 g/mol. Its IUPAC name is (6,6,6-trifluoro-2,2-dimethylhexan-3-yl)benzene.
| Compound Name | (6,6,6-trifluoro-2,2-dimethylhexan-3-yl)benzene |
|---|---|
| PubChem CID | 137470880 |
| Molecular Formula | C14H19F3 |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | (6,6,6-trifluoro-2,2-dimethylhexan-3-yl)benzene |
| SMILES | CC(C)(C)C(CCC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C14H19F3/c1-13(2,3)12(9-10-14(15,16)17)11-7-5-4-6-8-11/h4-8,12H,9-10H2,1-3H3 |
| InChIKey | MUXRZFLEILDXHY-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |