C16H26 — CID 546256
2,2,5,5-tetramethylhexan-3-ylbenzene (PubChem CID 546256) has the molecular formula C16H26 and a molecular weight of 218.38 g/mol. Its IUPAC name is 2,2,5,5-tetramethylhexan-3-ylbenzene.
| Compound Name | 2,2,5,5-tetramethylhexan-3-ylbenzene |
|---|---|
| PubChem CID | 546256 |
| Molecular Formula | C16H26 |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | 2,2,5,5-tetramethylhexan-3-ylbenzene |
| SMILES | CC(C)(C)CC(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C16H26/c1-15(2,3)12-14(16(4,5)6)13-10-8-7-9-11-13/h7-11,14H,12H2,1-6H3 |
| InChIKey | WGFFKVBHRMFZKS-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |