C24H34O2 — CID 149433737
[1-(3,3-dimethyl-1-phenylbutyl)peroxy-3,3-dimethylbutyl]benzene (PubChem CID 149433737) has the molecular formula C24H34O2 and a molecular weight of 354.53 g/mol. Its IUPAC name is [1-(3,3-dimethyl-1-phenylbutyl)peroxy-3,3-dimethylbutyl]benzene.
| Compound Name | [1-(3,3-dimethyl-1-phenylbutyl)peroxy-3,3-dimethylbutyl]benzene |
|---|---|
| PubChem CID | 149433737 |
| Molecular Formula | C24H34O2 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | [1-(3,3-dimethyl-1-phenylbutyl)peroxy-3,3-dimethylbutyl]benzene |
| SMILES | CC(C)(C)CC(OOC(CC(C)(C)C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H34O2/c1-23(2,3)17-21(19-13-9-7-10-14-19)25-26-22(18-24(4,5)6)20-15-11-8-12-16-20/h7-16,21-22H,17-18H2,1-6H3 |
| InChIKey | RPMHJWVSMDDQKP-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|