C12H20N2O2S — CID 112684756
[3,3-dimethyl-1-(sulfamoylamino)butyl]benzene (PubChem CID 112684756) has the molecular formula C12H20N2O2S and a molecular weight of 256.37 g/mol. Its IUPAC name is [3,3-dimethyl-1-(sulfamoylamino)butyl]benzene.
| Compound Name | [3,3-dimethyl-1-(sulfamoylamino)butyl]benzene |
|---|---|
| PubChem CID | 112684756 |
| Molecular Formula | C12H20N2O2S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | [3,3-dimethyl-1-(sulfamoylamino)butyl]benzene |
| SMILES | CC(C)(C)CC(NS(N)(=O)=O)c1ccccc1 |
| InChI | InChI=1S/C12H20N2O2S/c1-12(2,3)9-11(14-17(13,15)16)10-7-5-4-6-8-10/h4-8,11,14H,9H2,1-3H3,(H2,13,15,16) |
| InChIKey | PLUNBVPPLLWBAF-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |