C15H21N3O2S — CID 61273867
N-(3,3-dimethyl-1-phenylbutyl)-1H-pyrazole-4-sulfonamide (PubChem CID 61273867) has the molecular formula C15H21N3O2S and a molecular weight of 307.42 g/mol. Its IUPAC name is N-(3,3-dimethyl-1-phenylbutyl)-1H-pyrazole-4-sulfonamide.
| Compound Name | N-(3,3-dimethyl-1-phenylbutyl)-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 61273867 |
| Molecular Formula | C15H21N3O2S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | N-(3,3-dimethyl-1-phenylbutyl)-1H-pyrazole-4-sulfonamide |
| SMILES | CC(C)(C)CC(NS(=O)(=O)c1cn[nH]c1)c1ccccc1 |
| InChI | InChI=1S/C15H21N3O2S/c1-15(2,3)9-14(12-7-5-4-6-8-12)18-21(19,20)13-10-16-17-11-13/h4-8,10-11,14,18H,9H2,1-3H3,(H,16,17) |
| InChIKey | DCDREVYFYGHZSJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |