C17H25N3 — CID 106209318
3,3-dimethyl-1-phenyl-N-[1-(1H-pyrazol-4-yl)ethyl]butan-1-amine (PubChem CID 106209318) has the molecular formula C17H25N3 and a molecular weight of 271.41 g/mol. Its IUPAC name is 3,3-dimethyl-1-phenyl-N-[1-(1H-pyrazol-4-yl)ethyl]butan-1-amine.
| Compound Name | 3,3-dimethyl-1-phenyl-N-[1-(1H-pyrazol-4-yl)ethyl]butan-1-amine |
|---|---|
| PubChem CID | 106209318 |
| Molecular Formula | C17H25N3 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | 3,3-dimethyl-1-phenyl-N-[1-(1H-pyrazol-4-yl)ethyl]butan-1-amine |
| SMILES | CC(NC(CC(C)(C)C)c1ccccc1)c1cn[nH]c1 |
| InChI | InChI=1S/C17H25N3/c1-13(15-11-18-19-12-15)20-16(10-17(2,3)4)14-8-6-5-7-9-14/h5-9,11-13,16,20H,10H2,1-4H3,(H,18,19) |
| InChIKey | PSPRKXOMNUOOFA-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |