C22H28N6O2 — CID 166185847
3-methyl-3-phenyl-N,N'-bis[1-(1H-pyrazol-4-yl)ethyl]pentanediamide (PubChem CID 166185847) has the molecular formula C22H28N6O2 and a molecular weight of 408.51 g/mol. Its IUPAC name is 3-methyl-3-phenyl-N,N'-bis[1-(1H-pyrazol-4-yl)ethyl]pentanediamide.
| Compound Name | 3-methyl-3-phenyl-N,N'-bis[1-(1H-pyrazol-4-yl)ethyl]pentanediamide |
|---|---|
| PubChem CID | 166185847 |
| Molecular Formula | C22H28N6O2 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 3-methyl-3-phenyl-N,N'-bis[1-(1H-pyrazol-4-yl)ethyl]pentanediamide |
| SMILES | CC(NC(=O)CC(C)(CC(=O)NC(C)c1cn[nH]c1)c1ccccc1)c1cn[nH]c1 |
| InChI | InChI=1S/C22H28N6O2/c1-15(17-11-23-24-12-17)27-20(29)9-22(3,19-7-5-4-6-8-19)10-21(30)28-16(2)18-13-25-26-14-18/h4-8,11-16H,9-10H2,1-3H3,(H,23,24)(H,25,26)(H,27,29)(H,28,30) |
| InChIKey | JPANIQGDNPEMTF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |