C13H14FN3O — CID 103856392
2-(2-fluorophenyl)-N-[1-(1H-pyrazol-4-yl)ethyl]acetamide (PubChem CID 103856392) has the molecular formula C13H14FN3O and a molecular weight of 247.27 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-N-[1-(1H-pyrazol-4-yl)ethyl]acetamide.
| Compound Name | 2-(2-fluorophenyl)-N-[1-(1H-pyrazol-4-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 103856392 |
| Molecular Formula | C13H14FN3O |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 2-(2-fluorophenyl)-N-[1-(1H-pyrazol-4-yl)ethyl]acetamide |
| SMILES | CC(NC(=O)Cc1ccccc1F)c1cn[nH]c1 |
| InChI | InChI=1S/C13H14FN3O/c1-9(11-7-15-16-8-11)17-13(18)6-10-4-2-3-5-12(10)14/h2-5,7-9H,6H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | LPLSNDFTOORSLC-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |