C17H18F3N — CID 43755979
3,3,3-trifluoro-1-phenyl-N-(1-phenylethyl)propan-1-amine (PubChem CID 43755979) has the molecular formula C17H18F3N and a molecular weight of 293.33 g/mol. Its IUPAC name is 3,3,3-trifluoro-1-phenyl-N-(1-phenylethyl)propan-1-amine.
| Compound Name | 3,3,3-trifluoro-1-phenyl-N-(1-phenylethyl)propan-1-amine |
|---|---|
| PubChem CID | 43755979 |
| Molecular Formula | C17H18F3N |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 3,3,3-trifluoro-1-phenyl-N-(1-phenylethyl)propan-1-amine |
| SMILES | CC(NC(CC(F)(F)F)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H18F3N/c1-13(14-8-4-2-5-9-14)21-16(12-17(18,19)20)15-10-6-3-7-11-15/h2-11,13,16,21H,12H2,1H3 |
| InChIKey | MAKICKBUTUMWMI-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |