C12H12F3N — CID 43755356
3,3,3-trifluoro-1-phenyl-N-prop-2-ynylpropan-1-amine (PubChem CID 43755356) has the molecular formula C12H12F3N and a molecular weight of 227.23 g/mol. Its IUPAC name is 3,3,3-trifluoro-1-phenyl-N-prop-2-ynylpropan-1-amine.
| Compound Name | 3,3,3-trifluoro-1-phenyl-N-prop-2-ynylpropan-1-amine |
|---|---|
| PubChem CID | 43755356 |
| Molecular Formula | C12H12F3N |
| Molecular Weight | 227.23 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 3,3,3-trifluoro-1-phenyl-N-prop-2-ynylpropan-1-amine |
| SMILES | C#CCNC(CC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C12H12F3N/c1-2-8-16-11(9-12(13,14)15)10-6-4-3-5-7-10/h1,3-7,11,16H,8-9H2 |
| InChIKey | NYNABVPEMFWUGV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.23 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|