C15H18F3N — CID 106226313
N-(3,3,3-trifluoro-1-phenylpropyl)hex-1-yn-3-amine (PubChem CID 106226313) has the molecular formula C15H18F3N and a molecular weight of 269.31 g/mol. Its IUPAC name is N-(3,3,3-trifluoro-1-phenylpropyl)hex-1-yn-3-amine.
| Compound Name | N-(3,3,3-trifluoro-1-phenylpropyl)hex-1-yn-3-amine |
|---|---|
| PubChem CID | 106226313 |
| Molecular Formula | C15H18F3N |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | N-(3,3,3-trifluoro-1-phenylpropyl)hex-1-yn-3-amine |
| SMILES | C#CC(CCC)NC(CC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C15H18F3N/c1-3-8-13(4-2)19-14(11-15(16,17)18)12-9-6-5-7-10-12/h2,5-7,9-10,13-14,19H,3,8,11H2,1H3 |
| InChIKey | SETLKFBBRGZNMB-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|