C17H14F3N — CID 43755559
3-ethynyl-N-(3,3,3-trifluoro-1-phenylpropyl)aniline (PubChem CID 43755559) has the molecular formula C17H14F3N and a molecular weight of 289.30 g/mol. Its IUPAC name is 3-ethynyl-N-(3,3,3-trifluoro-1-phenylpropyl)aniline.
| Compound Name | 3-ethynyl-N-(3,3,3-trifluoro-1-phenylpropyl)aniline |
|---|---|
| PubChem CID | 43755559 |
| Molecular Formula | C17H14F3N |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 3-ethynyl-N-(3,3,3-trifluoro-1-phenylpropyl)aniline |
| SMILES | C#Cc1cccc(NC(CC(F)(F)F)c2ccccc2)c1 |
| InChI | InChI=1S/C17H14F3N/c1-2-13-7-6-10-15(11-13)21-16(12-17(18,19)20)14-8-4-3-5-9-14/h1,3-11,16,21H,12H2 |
| InChIKey | YMXSATHZTLYBSQ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|