C12H13F3N2 — CID 67579620
4,4,4-trifluoro-2-[[(1R)-1-phenylethyl]amino]butanenitrile (PubChem CID 67579620) has the molecular formula C12H13F3N2 and a molecular weight of 242.24 g/mol. Its IUPAC name is 4,4,4-trifluoro-2-[[(1R)-1-phenylethyl]amino]butanenitrile.
| Compound Name | 4,4,4-trifluoro-2-[[(1R)-1-phenylethyl]amino]butanenitrile |
|---|---|
| PubChem CID | 67579620 |
| Molecular Formula | C12H13F3N2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 4,4,4-trifluoro-2-[[(1R)-1-phenylethyl]amino]butanenitrile |
| SMILES | C[C@@H](NC(C#N)CC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C12H13F3N2/c1-9(10-5-3-2-4-6-10)17-11(8-16)7-12(13,14)15/h2-6,9,11,17H,7H2,1H3/t9-,11?/m1/s1 |
| InChIKey | DWWQMDZLPXOYNJ-BFHBGLAWSA-N |
| XLogP | 3.18 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |