C13H16F3NO — CID 10967206
(2R)-4,4,4-trifluoro-2-methyl-N-[(1S)-1-phenylethyl]butanamide (PubChem CID 10967206) has the molecular formula C13H16F3NO and a molecular weight of 259.27 g/mol. Its IUPAC name is (2R)-4,4,4-trifluoro-2-methyl-N-[(1S)-1-phenylethyl]butanamide.
| Compound Name | (2R)-4,4,4-trifluoro-2-methyl-N-[(1S)-1-phenylethyl]butanamide |
|---|---|
| PubChem CID | 10967206 |
| Molecular Formula | C13H16F3NO |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | (2R)-4,4,4-trifluoro-2-methyl-N-[(1S)-1-phenylethyl]butanamide |
| SMILES | C[C@H](CC(F)(F)F)C(=O)N[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C13H16F3NO/c1-9(8-13(14,15)16)12(18)17-10(2)11-6-4-3-5-7-11/h3-7,9-10H,8H2,1-2H3,(H,17,18)/t9-,10+/m1/s1 |
| InChIKey | NABPCZQQPQAPOW-ZJUUUORDSA-N |
| XLogP | 3.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |