C13H18N2 — CID 81356979
2-[[(1R)-1-(4-methylphenyl)ethyl]amino]butanenitrile (PubChem CID 81356979) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 2-[[(1R)-1-(4-methylphenyl)ethyl]amino]butanenitrile.
| Compound Name | 2-[[(1R)-1-(4-methylphenyl)ethyl]amino]butanenitrile |
|---|---|
| PubChem CID | 81356979 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 2-[[(1R)-1-(4-methylphenyl)ethyl]amino]butanenitrile |
| SMILES | CCC(C#N)N[C@H](C)c1ccc(C)cc1 |
| InChI | InChI=1S/C13H18N2/c1-4-13(9-14)15-11(3)12-7-5-10(2)6-8-12/h5-8,11,13,15H,4H2,1-3H3/t11-,13?/m1/s1 |
| InChIKey | SEGUUGYMSXVNBC-JTDNENJMSA-N |
| XLogP | 2.95 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |