C17H18N2 — CID 11747074
3-phenyl-2-[[(1R)-1-phenylethyl]amino]propanenitrile (PubChem CID 11747074) has the molecular formula C17H18N2 and a molecular weight of 250.35 g/mol. Its IUPAC name is 3-phenyl-2-[[(1R)-1-phenylethyl]amino]propanenitrile.
| Compound Name | 3-phenyl-2-[[(1R)-1-phenylethyl]amino]propanenitrile |
|---|---|
| PubChem CID | 11747074 |
| Molecular Formula | C17H18N2 |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 3-phenyl-2-[[(1R)-1-phenylethyl]amino]propanenitrile |
| SMILES | C[C@@H](NC(C#N)Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H18N2/c1-14(16-10-6-3-7-11-16)19-17(13-18)12-15-8-4-2-5-9-15/h2-11,14,17,19H,12H2,1H3/t14-,17?/m1/s1 |
| InChIKey | JWVMFZNKZFXETC-XPCCGILXSA-N |
| XLogP | 3.47 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |