C12H16N2O — CID 67860910
(2S)-2-(1-hydroxypropan-2-ylamino)-3-phenylpropanenitrile (PubChem CID 67860910) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is (2S)-2-(1-hydroxypropan-2-ylamino)-3-phenylpropanenitrile.
| Compound Name | (2S)-2-(1-hydroxypropan-2-ylamino)-3-phenylpropanenitrile |
|---|---|
| PubChem CID | 67860910 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | (2S)-2-(1-hydroxypropan-2-ylamino)-3-phenylpropanenitrile |
| SMILES | CC(CO)N[C@H](C#N)Cc1ccccc1 |
| InChI | InChI=1S/C12H16N2O/c1-10(9-15)14-12(8-13)7-11-5-3-2-4-6-11/h2-6,10,12,14-15H,7,9H2,1H3/t10?,12-/m0/s1 |
| InChIKey | OBICOBGIEZDCFK-KFJBMODSSA-N |
| XLogP | 1.09 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |