C17H17NO — CID 11288187
(2R,3R)-2-benzyl-4-hydroxy-3-phenylbutanenitrile (PubChem CID 11288187) has the molecular formula C17H17NO and a molecular weight of 251.33 g/mol. Its IUPAC name is (2R,3R)-2-benzyl-4-hydroxy-3-phenylbutanenitrile.
| Compound Name | (2R,3R)-2-benzyl-4-hydroxy-3-phenylbutanenitrile |
|---|---|
| PubChem CID | 11288187 |
| Molecular Formula | C17H17NO |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | (2R,3R)-2-benzyl-4-hydroxy-3-phenylbutanenitrile |
| SMILES | N#C[C@H](Cc1ccccc1)[C@@H](CO)c1ccccc1 |
| InChI | InChI=1S/C17H17NO/c18-12-16(11-14-7-3-1-4-8-14)17(13-19)15-9-5-2-6-10-15/h1-10,16-17,19H,11,13H2/t16-,17-/m0/s1 |
| InChIKey | ZLXRZNKZWOSGJX-IRXDYDNUSA-N |
| XLogP | 3.14 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |