C10H11NO2 — CID 130918257
(3S)-2,3-dihydroxy-4-phenylbutanenitrile (PubChem CID 130918257) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is (3S)-2,3-dihydroxy-4-phenylbutanenitrile.
| Compound Name | (3S)-2,3-dihydroxy-4-phenylbutanenitrile |
|---|---|
| PubChem CID | 130918257 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | (3S)-2,3-dihydroxy-4-phenylbutanenitrile |
| SMILES | N#CC(O)[C@@H](O)Cc1ccccc1 |
| InChI | InChI=1S/C10H11NO2/c11-7-10(13)9(12)6-8-4-2-1-3-5-8/h1-5,9-10,12-13H,6H2/t9-,10?/m0/s1 |
| InChIKey | KBZUOWVSLIFITP-RGURZIINSA-N |
| XLogP | 0.47 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|