C15H17NO2 — CID 171261356
2-[(1R,2S)-1-amino-2-hydroxy-3-phenylpropyl]phenol (PubChem CID 171261356) has the molecular formula C15H17NO2 and a molecular weight of 243.31 g/mol. Its IUPAC name is 2-[(1R,2S)-1-amino-2-hydroxy-3-phenylpropyl]phenol.
| Compound Name | 2-[(1R,2S)-1-amino-2-hydroxy-3-phenylpropyl]phenol |
|---|---|
| PubChem CID | 171261356 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | 2-[(1R,2S)-1-amino-2-hydroxy-3-phenylpropyl]phenol |
| SMILES | N[C@H](c1ccccc1O)[C@@H](O)Cc1ccccc1 |
| InChI | InChI=1S/C15H17NO2/c16-15(12-8-4-5-9-13(12)17)14(18)10-11-6-2-1-3-7-11/h1-9,14-15,17-18H,10,16H2/t14-,15+/m0/s1 |
| InChIKey | NCIGETVVLCMRCJ-LSDHHAIUSA-N |
| XLogP | 2.00 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|