C16H16F3NO2 — CID 171269826
(1S,2R)-1-amino-3-phenyl-1-[2-(trifluoromethoxy)phenyl]propan-2-ol (PubChem CID 171269826) has the molecular formula C16H16F3NO2 and a molecular weight of 311.30 g/mol. Its IUPAC name is (1S,2R)-1-amino-3-phenyl-1-[2-(trifluoromethoxy)phenyl]propan-2-ol.
| Compound Name | (1S,2R)-1-amino-3-phenyl-1-[2-(trifluoromethoxy)phenyl]propan-2-ol |
|---|---|
| PubChem CID | 171269826 |
| Molecular Formula | C16H16F3NO2 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | (1S,2R)-1-amino-3-phenyl-1-[2-(trifluoromethoxy)phenyl]propan-2-ol |
| SMILES | N[C@@H](c1ccccc1OC(F)(F)F)[C@H](O)Cc1ccccc1 |
| InChI | InChI=1S/C16H16F3NO2/c17-16(18,19)22-14-9-5-4-8-12(14)15(20)13(21)10-11-6-2-1-3-7-11/h1-9,13,15,21H,10,20H2/t13-,15+/m1/s1 |
| InChIKey | PEXGUDJWJVRIFI-HIFRSBDPSA-N |
| XLogP | 3.19 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |