C15H17NO3 — CID 171261361
3-[(1R,2S)-1-amino-2-hydroxy-3-phenylpropyl]benzene-1,2-diol (PubChem CID 171261361) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is 3-[(1R,2S)-1-amino-2-hydroxy-3-phenylpropyl]benzene-1,2-diol.
| Compound Name | 3-[(1R,2S)-1-amino-2-hydroxy-3-phenylpropyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 171261361 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 3-[(1R,2S)-1-amino-2-hydroxy-3-phenylpropyl]benzene-1,2-diol |
| SMILES | N[C@H](c1cccc(O)c1O)[C@@H](O)Cc1ccccc1 |
| InChI | InChI=1S/C15H17NO3/c16-14(11-7-4-8-12(17)15(11)19)13(18)9-10-5-2-1-3-6-10/h1-8,13-14,17-19H,9,16H2/t13-,14+/m0/s1 |
| InChIKey | XCFQMWQOGBYQIH-UONOGXRCSA-N |
| XLogP | 1.70 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|