C15H15ClFNO — CID 171263945
(1R,2S)-1-amino-1-(3-chloro-2-fluorophenyl)-3-phenylpropan-2-ol (PubChem CID 171263945) has the molecular formula C15H15ClFNO and a molecular weight of 279.74 g/mol. Its IUPAC name is (1R,2S)-1-amino-1-(3-chloro-2-fluorophenyl)-3-phenylpropan-2-ol.
| Compound Name | (1R,2S)-1-amino-1-(3-chloro-2-fluorophenyl)-3-phenylpropan-2-ol |
|---|---|
| PubChem CID | 171263945 |
| Molecular Formula | C15H15ClFNO |
| Molecular Weight | 279.74 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | (1R,2S)-1-amino-1-(3-chloro-2-fluorophenyl)-3-phenylpropan-2-ol |
| SMILES | N[C@H](c1cccc(Cl)c1F)[C@@H](O)Cc1ccccc1 |
| InChI | InChI=1S/C15H15ClFNO/c16-12-8-4-7-11(14(12)17)15(18)13(19)9-10-5-2-1-3-6-10/h1-8,13,15,19H,9,18H2/t13-,15+/m0/s1 |
| InChIKey | DWFNQUIRGGMBCI-DZGCQCFKSA-N |
| XLogP | 3.08 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.74 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |